Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Potassium oxalate monohydrate, 99+%, for analysis
CAS: 6487-48-5 Molecular Formula: C2H2K2O5 Molecular Weight (g/mol): 184.23 MDL Number: MFCD00150033 InChI Key: QCPTVXCMROGZOL-UHFFFAOYSA-L Synonym: potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate PubChem CID: 2724193 IUPAC Name: dipotassium;oxalate;hydrate SMILES: O.[K+].[K+].[O-]C(=O)C([O-])=O
| PubChem CID | 2724193 |
|---|---|
| CAS | 6487-48-5 |
| Molecular Weight (g/mol) | 184.23 |
| MDL Number | MFCD00150033 |
| SMILES | O.[K+].[K+].[O-]C(=O)C([O-])=O |
| Synonym | potassium oxalate monohydrate,potassium oxalate hydrate,oxalic acid potassium salt,ethanedioic acid, dipotassium salt, monohydrate,dipotassium oxalate hydrate,dipotassium hydrate oxalate,acmc-1bcm6,ksc495a4h,dipotassium oxalate monohydrate,dipotassium ethanedioate hydrate |
| IUPAC Name | dipotassium;oxalate;hydrate |
| InChI Key | QCPTVXCMROGZOL-UHFFFAOYSA-L |
| Molecular Formula | C2H2K2O5 |
Sodium methoxide, pure, anhydrous powder
CAS: 124-41-4 Molecular Formula: CH3NaO Molecular Weight (g/mol): 54.02 MDL Number: MFCD00012179 InChI Key: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC Name: sodium;methanolate SMILES: C[O-].[Na+]
| PubChem CID | 10942334 |
|---|---|
| CAS | 124-41-4 |
| Molecular Weight (g/mol) | 54.02 |
| MDL Number | MFCD00012179 |
| SMILES | C[O-].[Na+] |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| IUPAC Name | sodium;methanolate |
| InChI Key | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molecular Formula | CH3NaO |
Methyl p-toluenesulfonate, 97%
CAS: 80-48-8 Molecular Formula: C8H10O3S Molecular Weight (g/mol): 186.23 MDL Number: MFCD00008417 InChI Key: VUQUOGPMUUJORT-UHFFFAOYSA-N Synonym: methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester PubChem CID: 6645 IUPAC Name: methyl 4-methylbenzenesulfonate SMILES: CC1=CC=C(C=C1)S(=O)(=O)OC
| PubChem CID | 6645 |
|---|---|
| CAS | 80-48-8 |
| Molecular Weight (g/mol) | 186.23 |
| MDL Number | MFCD00008417 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC |
| Synonym | methyl p-toluenesulfonate,methyl tosylate,methyl p-tosylate,methyl toluene-4-sulfonate,methyl-p-toluenesulfonate,p-toluenesulfonic acid, methyl ester,benzenesulfonic acid, 4-methyl-, methyl ester,methyl toluene-4-sulphonate,p-toluenesulfonic acid methyl ester,p-methylbenzenesulfonate methyl ester |
| IUPAC Name | methyl 4-methylbenzenesulfonate |
| InChI Key | VUQUOGPMUUJORT-UHFFFAOYSA-N |
| Molecular Formula | C8H10O3S |
Morpholine, 99%
CAS: 110-91-8 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00005972 InChI Key: YNAVUWVOSKDBBP-UHFFFAOYSA-N Synonym: 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro PubChem CID: 8083 ChEBI: CHEBI:34856 IUPAC Name: morpholine SMILES: C1COCCN1
| PubChem CID | 8083 |
|---|---|
| CAS | 110-91-8 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:34856 |
| MDL Number | MFCD00005972 |
| SMILES | C1COCCN1 |
| Synonym | 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro |
| IUPAC Name | morpholine |
| InChI Key | YNAVUWVOSKDBBP-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
2-Hydroxyethyl acrylate, 97%, stabilized
CAS: 818-61-1 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00002865 InChI Key: OMIGHNLMNHATMP-UHFFFAOYSA-N Synonym: 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate PubChem CID: 13165 IUPAC Name: 2-hydroxyethyl prop-2-enoate SMILES: C=CC(=O)OCCO
| PubChem CID | 13165 |
|---|---|
| CAS | 818-61-1 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00002865 |
| SMILES | C=CC(=O)OCCO |
| Synonym | 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate |
| InChI Key | OMIGHNLMNHATMP-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
Phthalic Anhydride, 99%
CAS: 85-44-9 Molecular Formula: C8H4O3 Molecular Weight (g/mol): 148.12 MDL Number: MFCD00005918 InChI Key: LGRFSURHDFAFJT-UHFFFAOYSA-N Synonym: phthalic anhydride,isobenzofuran-1,3-dione,1,3-isobenzofurandione,1,3-dioxophthalan,1,3-phthalandione,phthalsaeureanhydrid,phthalic acid anhydride,o-phthalic acid anhydride,phthalandione,retarder esen PubChem CID: 6811 ChEBI: CHEBI:36605 SMILES: O=C1OC(=O)C2=CC=CC=C12
| PubChem CID | 6811 |
|---|---|
| CAS | 85-44-9 |
| Molecular Weight (g/mol) | 148.12 |
| ChEBI | CHEBI:36605 |
| MDL Number | MFCD00005918 |
| SMILES | O=C1OC(=O)C2=CC=CC=C12 |
| Synonym | phthalic anhydride,isobenzofuran-1,3-dione,1,3-isobenzofurandione,1,3-dioxophthalan,1,3-phthalandione,phthalsaeureanhydrid,phthalic acid anhydride,o-phthalic acid anhydride,phthalandione,retarder esen |
| InChI Key | LGRFSURHDFAFJT-UHFFFAOYSA-N |
| Molecular Formula | C8H4O3 |
| CAS | 8049-47-6 |
|---|---|
| Synonym | Diastase vera |
Tetraethylammonium chloride
CAS: 56-34-8 Molecular Formula: C8H20ClN Molecular Weight (g/mol): 165.71 MDL Number: MFCD00149992 InChI Key: YMBCJWGVCUEGHA-UHFFFAOYSA-M Synonym: tetraethylammonium chloride,tetraethyl ammonium chloride,etamon chloride,tea chloride,teac,n,n,n-triethylethanaminium chloride,tetraethylammoniumchloride,ethanaminium, n,n,n-triethyl-, chloride,tetraethyl-ammonium chloride,unii-8b82z83xnn PubChem CID: 5946 ChEBI: CHEBI:78161 IUPAC Name: tetraethylazanium;chloride SMILES: [Cl-].CC[N+](CC)(CC)CC
| PubChem CID | 5946 |
|---|---|
| CAS | 56-34-8 |
| Molecular Weight (g/mol) | 165.71 |
| ChEBI | CHEBI:78161 |
| MDL Number | MFCD00149992 |
| SMILES | [Cl-].CC[N+](CC)(CC)CC |
| Synonym | tetraethylammonium chloride,tetraethyl ammonium chloride,etamon chloride,tea chloride,teac,n,n,n-triethylethanaminium chloride,tetraethylammoniumchloride,ethanaminium, n,n,n-triethyl-, chloride,tetraethyl-ammonium chloride,unii-8b82z83xnn |
| IUPAC Name | tetraethylazanium;chloride |
| InChI Key | YMBCJWGVCUEGHA-UHFFFAOYSA-M |
| Molecular Formula | C8H20ClN |
Diethyldithiocarbamic acid, silver salt, ACS reagent
CAS: 1470-61-7 Molecular Formula: C5H10AgNS2 Molecular Weight (g/mol): 256.13 MDL Number: MFCD00004929 InChI Key: NSVHDIYWJVLAGH-UHFFFAOYSA-M Synonym: silver diethyldithiocarbamate,unii-gvn001b86o,agddtc,silver n,n-diethylcarbamodithioate,diethyldithiocarbamic acid, silver salt,diethyl dithio carbamic acid silver salt,silver i diethyldithiocarbamate,silver, diethylcarbamodithioato-ks,ks',ditiocarb silver,silver n,n-diethyldithiocarbamate PubChem CID: 3034078 IUPAC Name: silver;N,N-diethylcarbamodithioate SMILES: CCN(CC)C(=S)[S-].[Ag+]
| PubChem CID | 3034078 |
|---|---|
| CAS | 1470-61-7 |
| Molecular Weight (g/mol) | 256.13 |
| MDL Number | MFCD00004929 |
| SMILES | CCN(CC)C(=S)[S-].[Ag+] |
| Synonym | silver diethyldithiocarbamate,unii-gvn001b86o,agddtc,silver n,n-diethylcarbamodithioate,diethyldithiocarbamic acid, silver salt,diethyl dithio carbamic acid silver salt,silver i diethyldithiocarbamate,silver, diethylcarbamodithioato-ks,ks',ditiocarb silver,silver n,n-diethyldithiocarbamate |
| IUPAC Name | silver;N,N-diethylcarbamodithioate |
| InChI Key | NSVHDIYWJVLAGH-UHFFFAOYSA-M |
| Molecular Formula | C5H10AgNS2 |
2-Methylbutane, 99+%, extra pure
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Chitosan, 85% deacetylated
CAS: 9012-76-4 Molecular Formula: C56H103N9O39 Molecular Weight (g/mol): 1526.464 MDL Number: MFCD00161512 InChI Key: FLASNYPZGWUPSU-SICDJOISSA-N Synonym: chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f PubChem CID: 71853 IUPAC Name: methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy SMILES: COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O
| PubChem CID | 71853 |
|---|---|
| CAS | 9012-76-4 |
| Molecular Weight (g/mol) | 1526.464 |
| MDL Number | MFCD00161512 |
| SMILES | COC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)OC3C(OC(C(C3O)N)O)CO)CO)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)N)O)N)O)N)O)N)O)N)O)N)O |
| Synonym | chitosan,poliglusam,deacetylchitin,chicol,flonac c,flonac n,sea cure plus,kytex h,kytex m,kimitsu chitosan f |
| IUPAC Name | methyl N-[(2S,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-5-[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-hydroxy-6-(hy |
| InChI Key | FLASNYPZGWUPSU-SICDJOISSA-N |
| Molecular Formula | C56H103N9O39 |
Ethylbenzene, ≥99 %
CAS: 100-41-4 Molecular Formula: C8H10 Molecular Weight (g/mol): 106.168 MDL Number: MFCD00011647 InChI Key: YNQLUTRBYVCPMQ-UHFFFAOYSA-N Synonym: phenylethane,ethylbenzol,benzene, ethyl,aethylbenzol,ethylenzene,ethyl benzene,ethylbenzeen,etilbenzene,etylobenzen,alpha-methyltoluene PubChem CID: 7500 ChEBI: CHEBI:16101 IUPAC Name: ethylbenzene SMILES: CCC1=CC=CC=C1
| PubChem CID | 7500 |
|---|---|
| CAS | 100-41-4 |
| Molecular Weight (g/mol) | 106.168 |
| ChEBI | CHEBI:16101 |
| MDL Number | MFCD00011647 |
| SMILES | CCC1=CC=CC=C1 |
| Synonym | phenylethane,ethylbenzol,benzene, ethyl,aethylbenzol,ethylenzene,ethyl benzene,ethylbenzeen,etilbenzene,etylobenzen,alpha-methyltoluene |
| IUPAC Name | ethylbenzene |
| InChI Key | YNQLUTRBYVCPMQ-UHFFFAOYSA-N |
| Molecular Formula | C8H10 |
Thermo Scientific Chemicals Urea, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Styrene-4-sulfonic acid sodium salt
CAS: 2695-37-6 Molecular Formula: C8H7NaO3S Molecular Weight (g/mol): 206.19 MDL Number: MFCD00013379 MFCD00084449 InChI Key: XFTALRAZSCGSKN-UHFFFAOYSA-M Synonym: sodium 4-vinylbenzenesulfonate,sodium p-styrenesulfonate,sodium 4-styrenesulfonate,sodium p-styrene sulfonate,unii-0kp0v3og5g,benzenesulfonic acid, 4-ethenyl-, sodium salt,poly sodium 4-vinylbenzenesulfonate,0kp0v3og5g,sodium 4-ethenylbenzenesulfonate,p-styrenesulfonic acid sodium salt PubChem CID: 3571582 IUPAC Name: sodium;4-ethenylbenzenesulfonate SMILES: [Na+].[O-]S(=O)(=O)C1=CC=C(C=C)C=C1
| PubChem CID | 3571582 |
|---|---|
| CAS | 2695-37-6 |
| Molecular Weight (g/mol) | 206.19 |
| MDL Number | MFCD00013379 MFCD00084449 |
| SMILES | [Na+].[O-]S(=O)(=O)C1=CC=C(C=C)C=C1 |
| Synonym | sodium 4-vinylbenzenesulfonate,sodium p-styrenesulfonate,sodium 4-styrenesulfonate,sodium p-styrene sulfonate,unii-0kp0v3og5g,benzenesulfonic acid, 4-ethenyl-, sodium salt,poly sodium 4-vinylbenzenesulfonate,0kp0v3og5g,sodium 4-ethenylbenzenesulfonate,p-styrenesulfonic acid sodium salt |
| IUPAC Name | sodium;4-ethenylbenzenesulfonate |
| InChI Key | XFTALRAZSCGSKN-UHFFFAOYSA-M |
| Molecular Formula | C8H7NaO3S |
Acetic Anhydride, ACS, MilliporeSigma™
CAS: 108-24-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.089 InChI Key: WFDIJRYMOXRFFG-UHFFFAOYSA-N Synonym: acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique PubChem CID: 7918 ChEBI: CHEBI:36610 IUPAC Name: acetyl acetate SMILES: CC(=O)OC(=O)C
| PubChem CID | 7918 |
|---|---|
| CAS | 108-24-7 |
| Molecular Weight (g/mol) | 102.089 |
| ChEBI | CHEBI:36610 |
| SMILES | CC(=O)OC(=O)C |
| Synonym | acetic anhydride,acetanhydride,acetic acid, anhydride,acetic oxide,acetyl oxide,ethanoic anhydride,acetyl ether,acetyl anhydride,acetic acid anhydride,anhydride acetique |
| IUPAC Name | acetyl acetate |
| InChI Key | WFDIJRYMOXRFFG-UHFFFAOYSA-N |
| Molecular Formula | C4H6O3 |