Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals Chlorogenic acid, 98%
CAS: 327-97-9 Molecular Formula: C16H18O9 Molecular Weight (g/mol): 354.31 MDL Number: MFCD00003862 InChI Key: CWVRJTMFETXNAD-JUHZACGLSA-N Synonym: chlorogenic acid,3-caffeoylquinic acid,chlorogenate,3-o-caffeoylquinic acid,3-3,4-dihydroxycinnamoyl quinic acid,heriguard,hlorogenic acid,caffeoyl quinic acid,3-caffeoylquinate,unii-318adp12ri PubChem CID: 1794427 ChEBI: CHEBI:16112 IUPAC Name: (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid SMILES: O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O
| PubChem CID | 1794427 |
|---|---|
| CAS | 327-97-9 |
| Molecular Weight (g/mol) | 354.31 |
| ChEBI | CHEBI:16112 |
| MDL Number | MFCD00003862 |
| SMILES | O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC=C(O)C(O)=C2)[C@@H]1O)C(O)=O |
| Synonym | chlorogenic acid,3-caffeoylquinic acid,chlorogenate,3-o-caffeoylquinic acid,3-3,4-dihydroxycinnamoyl quinic acid,heriguard,hlorogenic acid,caffeoyl quinic acid,3-caffeoylquinate,unii-318adp12ri |
| IUPAC Name | (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid |
| InChI Key | CWVRJTMFETXNAD-JUHZACGLSA-N |
| Molecular Formula | C16H18O9 |
Trolox™, 97%
CAS: 53188-07-1 Molecular Formula: C14H18O4 Molecular Weight (g/mol): 250.29 MDL Number: MFCD00006846 InChI Key: GLEVLJDDWXEYCO-UHFFFAOYNA-N Synonym: trolox,6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid,trolox c,3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-2h-1-benzopyran-2-carboxylic acid,6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid,2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl,+/--6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid,2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-, +-,trolox™,trolox tm PubChem CID: 40634 ChEBI: CHEBI:82625 IUPAC Name: 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid SMILES: CC1=C(C)C2=C(CCC(C)(O2)C(O)=O)C(C)=C1O
| PubChem CID | 40634 |
|---|---|
| CAS | 53188-07-1 |
| Molecular Weight (g/mol) | 250.29 |
| ChEBI | CHEBI:82625 |
| MDL Number | MFCD00006846 |
| SMILES | CC1=C(C)C2=C(CCC(C)(O2)C(O)=O)C(C)=C1O |
| Synonym | trolox,6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid,trolox c,3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-2h-1-benzopyran-2-carboxylic acid,6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid,2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl,+/--6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid,2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-, +-,trolox™,trolox tm |
| IUPAC Name | 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| InChI Key | GLEVLJDDWXEYCO-UHFFFAOYNA-N |
| Molecular Formula | C14H18O4 |
Potassium hydrogen phthalate, 99%
CAS: 877-24-7 Molecular Formula: C8H5KO4 Molecular Weight (g/mol): 204.222 MDL Number: MFCD00013070 InChI Key: IWZKICVEHNUQTL-UHFFFAOYSA-M Synonym: potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic PubChem CID: 23676735 IUPAC Name: potassium;2-carboxybenzoate SMILES: C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+]
| PubChem CID | 23676735 |
|---|---|
| CAS | 877-24-7 |
| Molecular Weight (g/mol) | 204.222 |
| MDL Number | MFCD00013070 |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| Synonym | potassium hydrogen phthalate,potassium biphthalate,monopotassium phthalate,potassium acid phthalate,hydrogen potassium phthalate,phthalic acid monopotassium salt,1,2-benzenedicarboxylic acid, monopotassium salt,phthalic acid, monopotassium salt,phthalic acid potassium salt,potassium phthalate monobasic |
| IUPAC Name | potassium;2-carboxybenzoate |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Molecular Formula | C8H5KO4 |
Diethylamine hydrochloride, 99%, Thermo Scientific Chemicals
CAS: 660-68-4 Molecular Formula: C4H12ClN Molecular Weight (g/mol): 109.597 MDL Number: MFCD00012499 InChI Key: HDITUCONWLWUJR-UHFFFAOYSA-N Synonym: diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl PubChem CID: 10197650 IUPAC Name: N-ethylethanamine;hydrochloride SMILES: CCNCC.Cl
| PubChem CID | 10197650 |
|---|---|
| CAS | 660-68-4 |
| Molecular Weight (g/mol) | 109.597 |
| MDL Number | MFCD00012499 |
| SMILES | CCNCC.Cl |
| Synonym | diethylamine hydrochloride,diethylammonium chloride,diethyl amine hydrochloride,n-ethylethanamine hydrochloride,ethanamine, n-ethyl-, hydrochloride,unii-ze9v3g1135,ethanamine, n-ethyl-, hydrochloride 1:1,diethylaminehydrochloride,diethylamine hcl,diethyl amine hcl |
| IUPAC Name | N-ethylethanamine;hydrochloride |
| InChI Key | HDITUCONWLWUJR-UHFFFAOYSA-N |
| Molecular Formula | C4H12ClN |
Polyvinylsulfuric acid potassium salt, approx. M.W. 175,000
CAS: 26837-42-3 Molecular Formula: (C2H3KO4S)n Molecular Weight (g/mol): NaN MDL Number: MFCD00081923 InChI Key: WZAPMUSQALINQD-UHFFFAOYSA-M Synonym: pvsk,potassium ethenyl sulfate,potassium poly vinyl sulfate,polyvinyl sulfate potassium salt,sulfuric acid, monovinyl ester, polymers, potassium salt,sulfuric acid, monoethenyl ester, homopolymer, potassium salt,vinyl sulfate potassium salt,sulfuric acid vinyl=potassium salt PubChem CID: 5055241 SMILES: [K]OS(=O)(=O)OC(-*)C-*
| PubChem CID | 5055241 |
|---|---|
| CAS | 26837-42-3 |
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00081923 |
| SMILES | [K]OS(=O)(=O)OC(-*)C-* |
| Synonym | pvsk,potassium ethenyl sulfate,potassium poly vinyl sulfate,polyvinyl sulfate potassium salt,sulfuric acid, monovinyl ester, polymers, potassium salt,sulfuric acid, monoethenyl ester, homopolymer, potassium salt,vinyl sulfate potassium salt,sulfuric acid vinyl=potassium salt |
| InChI Key | WZAPMUSQALINQD-UHFFFAOYSA-M |
| Molecular Formula | (C2H3KO4S)n |
1-Hexene, 97%
CAS: 592-41-6 Molecular Formula: C6H12 Molecular Weight (g/mol): 84.15 MDL Number: MFCD00009505 InChI Key: LIKMAJRDDDTEIG-UHFFFAOYSA-N Synonym: 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 PubChem CID: 11597 ChEBI: CHEBI:24579 IUPAC Name: hex-1-ene SMILES: CCCCC=C
| PubChem CID | 11597 |
|---|---|
| CAS | 592-41-6 |
| Molecular Weight (g/mol) | 84.15 |
| ChEBI | CHEBI:24579 |
| MDL Number | MFCD00009505 |
| SMILES | CCCCC=C |
| Synonym | 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 |
| IUPAC Name | hex-1-ene |
| InChI Key | LIKMAJRDDDTEIG-UHFFFAOYSA-N |
| Molecular Formula | C6H12 |
Aluminum tri-sec-butoxide, 97%
CAS: 2269-22-9 Molecular Formula: C12H27AlO3 Molecular Weight (g/mol): 246.33 MDL Number: MFCD00009327 InChI Key: LWGPRERTOLVRLK-UHFFFAOYSA-N Synonym: aluminum sec-butoxide,aluminum tri-sec-butoxide,2-butanol, aluminum salt,aluminum sec-butylate,aluminum butan-2-olate,aluminum tri-s-butoxide,2-butanol, aluminum salt 3:1,aluminum tri-sec-butanolate,al o-sec-bu 3,aluminiumtri-sec-butoxide PubChem CID: 50931103 IUPAC Name: aluminum;butan-2-ol SMILES: CCC(C)O.CCC(C)O.CCC(C)O.[Al]
| PubChem CID | 50931103 |
|---|---|
| CAS | 2269-22-9 |
| Molecular Weight (g/mol) | 246.33 |
| MDL Number | MFCD00009327 |
| SMILES | CCC(C)O.CCC(C)O.CCC(C)O.[Al] |
| Synonym | aluminum sec-butoxide,aluminum tri-sec-butoxide,2-butanol, aluminum salt,aluminum sec-butylate,aluminum butan-2-olate,aluminum tri-s-butoxide,2-butanol, aluminum salt 3:1,aluminum tri-sec-butanolate,al o-sec-bu 3,aluminiumtri-sec-butoxide |
| IUPAC Name | aluminum;butan-2-ol |
| InChI Key | LWGPRERTOLVRLK-UHFFFAOYSA-N |
| Molecular Formula | C12H27AlO3 |
N,N-Dimethyl-1-dodecylamine N-oxide, 95%
CAS: 1643-20-5 Molecular Formula: C14H31NO Molecular Weight (g/mol): 229.408 MDL Number: MFCD00002049 InChI Key: SYELZBGXAIXKHU-UHFFFAOYSA-N Synonym: lauramine oxide,lauryldimethylamine oxide,dodecyldimethylamine oxide,lauryldimethylamine n-oxide,ldao,ammonyx ao,ammonyx lo,empigen ob,aromox dmcd,conco xal PubChem CID: 15433 IUPAC Name: N,N-dimethyldodecan-1-amine oxide SMILES: CCCCCCCCCCCC[N+](C)(C)[O-]
| PubChem CID | 15433 |
|---|---|
| CAS | 1643-20-5 |
| Molecular Weight (g/mol) | 229.408 |
| MDL Number | MFCD00002049 |
| SMILES | CCCCCCCCCCCC[N+](C)(C)[O-] |
| Synonym | lauramine oxide,lauryldimethylamine oxide,dodecyldimethylamine oxide,lauryldimethylamine n-oxide,ldao,ammonyx ao,ammonyx lo,empigen ob,aromox dmcd,conco xal |
| IUPAC Name | N,N-dimethyldodecan-1-amine oxide |
| InChI Key | SYELZBGXAIXKHU-UHFFFAOYSA-N |
| Molecular Formula | C14H31NO |
9-Fluorenol, 98+%
CAS: 1689-64-1 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.222 MDL Number: MFCD00001135 InChI Key: AFMVESZOYKHDBJ-UHFFFAOYSA-N Synonym: 9-hydroxyfluorene,9-fluorenol,fluoren-9-ol,fluorenol,9-hydroxy fluorene,diphenylene carbinol,unii-bv0q72r613,hydroxyfluoren,9-hydroxy-fluoren,9h-fluorene-9-ol PubChem CID: 74318 ChEBI: CHEBI:16904 IUPAC Name: 9H-fluoren-9-ol SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)O
| PubChem CID | 74318 |
|---|---|
| CAS | 1689-64-1 |
| Molecular Weight (g/mol) | 182.222 |
| ChEBI | CHEBI:16904 |
| MDL Number | MFCD00001135 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)O |
| Synonym | 9-hydroxyfluorene,9-fluorenol,fluoren-9-ol,fluorenol,9-hydroxy fluorene,diphenylene carbinol,unii-bv0q72r613,hydroxyfluoren,9-hydroxy-fluoren,9h-fluorene-9-ol |
| IUPAC Name | 9H-fluoren-9-ol |
| InChI Key | AFMVESZOYKHDBJ-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Polyvinyl alcohol, 98-99% hydrolyzed, high molecular weight
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Perfluorohexanes, 98+%, Thermo Scientific Chemicals
CAS: 355-42-0 Molecular Formula: C6F14 Molecular Weight (g/mol): 338.044 MDL Number: MFCD00000437 InChI Key: ZJIJAJXFLBMLCK-UHFFFAOYSA-N Synonym: perfluorohexane,perflexane,tetradecafluorohexane,perfluoro-n-hexane,flutec pp1,hexane, tetradecafluoro,n-tetradecafluorohexane,fluorinert fc72,perfluorohexanes,perflexane usan:inn PubChem CID: 9639 ChEBI: CHEBI:39427 IUPAC Name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane SMILES: C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F
| PubChem CID | 9639 |
|---|---|
| CAS | 355-42-0 |
| Molecular Weight (g/mol) | 338.044 |
| ChEBI | CHEBI:39427 |
| MDL Number | MFCD00000437 |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F |
| Synonym | perfluorohexane,perflexane,tetradecafluorohexane,perfluoro-n-hexane,flutec pp1,hexane, tetradecafluoro,n-tetradecafluorohexane,fluorinert fc72,perfluorohexanes,perflexane usan:inn |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane |
| InChI Key | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| Molecular Formula | C6F14 |
2-Bromoethylamine hydrobromide, 99%
CAS: 2576-47-8 Molecular Formula: C2H6BrN·HBr Molecular Weight (g/mol): 204.9 MDL Number: MFCD00012886 InChI Key: WJAXXWSZNSFVNG-UHFFFAOYSA-N Synonym: 2-bromoethylamine hydrobromide,2-bromoethanamine hydrobromide,2-aminoethyl bromide hydrobromide,2-bromoethylamine hbr,2-bromoethylammonium bromide,ethanamine, 2-bromo-, hydrobromide,2-bromoethan-1-amine hydrobromide,bromoethylamine hydrobromide,aminoethyl bromide hbr,ethylamine, hydrobromide PubChem CID: 2774217 IUPAC Name: 2-bromoethanamine;hydrobromide SMILES: C(CBr)N.Br
| PubChem CID | 2774217 |
|---|---|
| CAS | 2576-47-8 |
| Molecular Weight (g/mol) | 204.9 |
| MDL Number | MFCD00012886 |
| SMILES | C(CBr)N.Br |
| Synonym | 2-bromoethylamine hydrobromide,2-bromoethanamine hydrobromide,2-aminoethyl bromide hydrobromide,2-bromoethylamine hbr,2-bromoethylammonium bromide,ethanamine, 2-bromo-, hydrobromide,2-bromoethan-1-amine hydrobromide,bromoethylamine hydrobromide,aminoethyl bromide hbr,ethylamine, hydrobromide |
| IUPAC Name | 2-bromoethanamine;hydrobromide |
| InChI Key | WJAXXWSZNSFVNG-UHFFFAOYSA-N |
| Molecular Formula | C2H6BrN·HBr |
2-Naphthol, 99+%
CAS: 135-19-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004067 InChI Key: JWAZRIHNYRIHIV-UHFFFAOYSA-N Synonym: 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol PubChem CID: 8663 ChEBI: CHEBI:10432 IUPAC Name: naphthalen-2-ol SMILES: C1=CC=C2C=C(C=CC2=C1)O
| PubChem CID | 8663 |
|---|---|
| CAS | 135-19-3 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:10432 |
| MDL Number | MFCD00004067 |
| SMILES | C1=CC=C2C=C(C=CC2=C1)O |
| Synonym | 2-naphthol,2-naphthalenol,beta-naphthol,2-hydroxynaphthalene,betanaphthol,isonaphthol,developer bn,naphthol b,azogen developer a,beta-napthol |
| IUPAC Name | naphthalen-2-ol |
| InChI Key | JWAZRIHNYRIHIV-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |
Gibco™ Fetal Bovine Serum, Value
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Gibco fetal bovine sera offer an excellent value for basic cell culture, specialty research, and specific assays.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
| Purity or Quality Grade | Value |
|---|---|
| Sterilization Method | Triple-filtered, 0.1 μm |
| Product Type | Fetal Bovine Serum |
| For Use With (Application) | *FBS import requirements vary globally, and acceptance depends on whether competent authorities allow import from a specific country of origin. Please check applicable regulations for the export of FBS and any FBS-containing products (e.g., cultured cells). Contact your Thermo Fisher Scientific representative for support. |
| Sterility | Sterile |
| Country of Origin | Refer to CoA for specific origin* |
| Age | Fetal |
Sodium beta-glycerophosphate pentahydrate, 97%
CAS: 13408-09-8 Molecular Formula: C3H19Na2O11P Molecular Weight (g/mol): 308.13 MDL Number: MFCD00149083,MFCD00002135,MFCD00149083,MFCD00149084,MFCD00002135 InChI Key: VWVLGHQKEJESPW-UHFFFAOYSA-N Synonym: unii-5jiy5mmx0e,5jiy5mmx0e,sodium 2-glycerophosphate pentahydrate,sodium beta-glycerophosphate pentahydrate,sodium 1,3-dihydroxypropan-2-yl phosphate pentahydrate,glycerol 2-phosphate,c3h7na2o6p.5h2o,beta-glycerophosphate, disodium salt, pentahydrate,beta-glycerol phosphate disodium salt pentahydrate,beta-glycerophosphoric acid disodium salt pentahydrate PubChem CID: 131846916 IUPAC Name: 1,3-dihydroxypropan-2-yl dihydrogen phosphate;sodium;pentahydrate SMILES: O.O.O.O.O.[Na].[Na].OCC(CO)OP(O)(O)=O
| PubChem CID | 131846916 |
|---|---|
| CAS | 13408-09-8 |
| Molecular Weight (g/mol) | 308.13 |
| MDL Number | MFCD00149083,MFCD00002135,MFCD00149083,MFCD00149084,MFCD00002135 |
| SMILES | O.O.O.O.O.[Na].[Na].OCC(CO)OP(O)(O)=O |
| Synonym | unii-5jiy5mmx0e,5jiy5mmx0e,sodium 2-glycerophosphate pentahydrate,sodium beta-glycerophosphate pentahydrate,sodium 1,3-dihydroxypropan-2-yl phosphate pentahydrate,glycerol 2-phosphate,c3h7na2o6p.5h2o,beta-glycerophosphate, disodium salt, pentahydrate,beta-glycerol phosphate disodium salt pentahydrate,beta-glycerophosphoric acid disodium salt pentahydrate |
| IUPAC Name | 1,3-dihydroxypropan-2-yl dihydrogen phosphate;sodium;pentahydrate |
| InChI Key | VWVLGHQKEJESPW-UHFFFAOYSA-N |
| Molecular Formula | C3H19Na2O11P |